C13H18N2O4 — CID 115884620
N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-4-nitrobenzamide (PubChem CID 115884620) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-4-nitrobenzamide.
| Compound Name | N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 115884620 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NC(C)(C)C(C)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O4/c1-8-7-10(5-6-11(8)15(18)19)12(17)14-13(3,4)9(2)16/h5-7,9,16H,1-4H3,(H,14,17) |
| InChIKey | GYNLLAJSESJICV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|