C12H23N3O2S — CID 115885692
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-ethylsulfonylpropan-2-amine (PubChem CID 115885692) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-ethylsulfonylpropan-2-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-ethylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 115885692 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-ethylsulfonylpropan-2-amine |
| SMILES | CCc1nn(C)cc1CNC(C)CS(=O)(=O)CC |
| InChI | InChI=1S/C12H23N3O2S/c1-5-12-11(8-15(4)14-12)7-13-10(3)9-18(16,17)6-2/h8,10,13H,5-7,9H2,1-4H3 |
| InChIKey | QXPHGVCDLCREDU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |