C13H18N2O3 — CID 115885984
3-ethoxy-N-[(2-methylcyclopropyl)methyl]-4-nitroaniline (PubChem CID 115885984) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-ethoxy-N-[(2-methylcyclopropyl)methyl]-4-nitroaniline.
| Compound Name | 3-ethoxy-N-[(2-methylcyclopropyl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 115885984 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-ethoxy-N-[(2-methylcyclopropyl)methyl]-4-nitroaniline |
| SMILES | CCOc1cc(NCC2CC2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O3/c1-3-18-13-7-11(4-5-12(13)15(16)17)14-8-10-6-9(10)2/h4-5,7,9-10,14H,3,6,8H2,1-2H3 |
| InChIKey | LTAOTMKLCLAZEQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|