About N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide
N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide (PubChem CID 11588666) has the molecular formula C18H23NO5S
and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide |
| PubChem CID | 11588666 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)N(c1cc(CCc2ccc(O)c(O)c2)ccc1O)S(C)(=O)=O |
| InChI | InChI=1S/C18H23NO5S/c1-12(2)19(25(3,23)24)15-10-13(6-8-16(15)20)4-5-14-7-9-17(21)18(22)11-14/h6-12,20-22H,4-5H2,1-3H3 |
| InChIKey | FZFRCROKHKBRQO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide?
The IUPAC name of N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide (CID 11588666) is N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide.
What is the SMILES notation for N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide?
The canonical SMILES for N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide is CC(C)N(c1cc(CCc2ccc(O)c(O)c2)ccc1O)S(C)(=O)=O.
What is the InChIKey of N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide?
The InChIKey is FZFRCROKHKBRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO5S/c1-12(2)19(25(3,23)24)15-10-13(6-8-16(15)20)4-5-14-7-9-17(21)18(22)11-14/h6-12,20-22H,4-5H2,1-3H3.
What are the key properties of N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide?
N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide has a molecular weight of 365.45 g/mol, XLogP of 2.76, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[2-(3,4-dihydroxyphenyl)ethyl]-2-hydroxyphenyl]-N-propan-2-ylmethanesulfonamide is sourced from PubChem (CID 11588666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).