C21H29N3O3 — CID 11588794
3-[[3-(3-aminopropylamino)propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 11588794) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-[[3-(3-aminopropylamino)propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-[[3-(3-aminopropylamino)propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11588794 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 3-[[3-(3-aminopropylamino)propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1CNCCCNCCCN |
| InChI | InChI=1S/C21H29N3O3/c1-13-10-19(25)27-20-14(2)21-17(11-16(13)20)18(15(3)26-21)12-24-9-5-8-23-7-4-6-22/h10-11,23-24H,4-9,12,22H2,1-3H3 |
| InChIKey | INRBNCCUOLONEF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|