C10H20N2O3S — CID 115889214
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]oxan-3-amine (PubChem CID 115889214) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]oxan-3-amine.
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]oxan-3-amine |
|---|---|
| PubChem CID | 115889214 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]oxan-3-amine |
| SMILES | O=S1(=O)CCCN1CCNC1CCCOC1 |
| InChI | InChI=1S/C10H20N2O3S/c13-16(14)8-2-5-12(16)6-4-11-10-3-1-7-15-9-10/h10-11H,1-9H2 |
| InChIKey | CWBDWUHCBKSBHJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |