C22H27N5O — CID 11588927
N-(2-ethyl-4-methoxyphenyl)-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-amine (PubChem CID 11588927) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(2-ethyl-4-methoxyphenyl)-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-amine.
| Compound Name | N-(2-ethyl-4-methoxyphenyl)-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-amine |
|---|---|
| PubChem CID | 11588927 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-(2-ethyl-4-methoxyphenyl)-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-7-amine |
| SMILES | CCc1cc(OC)ccc1Nc1nc2ccnn2c2c1ccn2C(CC)CC |
| InChI | InChI=1S/C22H27N5O/c1-5-15-14-17(28-4)8-9-19(15)24-21-18-11-13-26(16(6-2)7-3)22(18)27-20(25-21)10-12-23-27/h8-14,16H,5-7H2,1-4H3,(H,24,25) |
| InChIKey | JWJSWPQPNAEHNQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |