About 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one
1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one (PubChem CID 115889688) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one |
| PubChem CID | 115889688 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one |
| SMILES | CC1CC(NC(C)C(=O)N2CCOCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-12-9-14(11-16(3,4)10-12)17-13(2)15(19)18-5-7-20-8-6-18/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | YNWCJOJXWFNXTI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one?
The IUPAC name of 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one (CID 115889688) is 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one.
What is the SMILES notation for 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one?
The canonical SMILES for 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one is CC1CC(NC(C)C(=O)N2CCOCC2)CC(C)(C)C1.
What is the InChIKey of 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one?
The InChIKey is YNWCJOJXWFNXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2/c1-12-9-14(11-16(3,4)10-12)17-13(2)15(19)18-5-7-20-8-6-18/h12-14,17H,5-11H2,1-4H3.
What are the key properties of 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one?
1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one has a molecular weight of 282.43 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-2-[(3,3,5-trimethylcyclohexyl)amino]propan-1-one is sourced from PubChem (CID 115889688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).