C22H26FN3O2 — CID 11589055
N-[[(5R)-3-[4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide (PubChem CID 11589055) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[[(5R)-3-[4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide.
| Compound Name | N-[[(5R)-3-[4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11589055 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[[(5R)-3-[4-[4-[(3-fluoropropylamino)methyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CC(c2ccc(-c3ccc(CNCCCF)cc3)cc2)=NO1 |
| InChI | InChI=1S/C22H26FN3O2/c1-16(27)25-15-21-13-22(26-28-21)20-9-7-19(8-10-20)18-5-3-17(4-6-18)14-24-12-2-11-23/h3-10,21,24H,2,11-15H2,1H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | NUERRTOLBORRSG-OAQYLSRUSA-N |
| XLogP | 3.43 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|