C10H18F3NO2 — CID 115890636
1-(oxolan-3-yl)-2-(4,4,4-trifluorobutan-2-ylamino)ethanol (PubChem CID 115890636) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(4,4,4-trifluorobutan-2-ylamino)ethanol.
| Compound Name | 1-(oxolan-3-yl)-2-(4,4,4-trifluorobutan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 115890636 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(4,4,4-trifluorobutan-2-ylamino)ethanol |
| SMILES | CC(CC(F)(F)F)NCC(O)C1CCOC1 |
| InChI | InChI=1S/C10H18F3NO2/c1-7(4-10(11,12)13)14-5-9(15)8-2-3-16-6-8/h7-9,14-15H,2-6H2,1H3 |
| InChIKey | BIBVOCOKUFQCJW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |