C19H22N4O5 — CID 11589125
N-[4-amino-5-cyano-6-(2-methoxyethoxy)-2-pyridinyl]-2-(2,5-dimethoxyphenyl)acetamide (PubChem CID 11589125) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-[4-amino-5-cyano-6-(2-methoxyethoxy)-2-pyridinyl]-2-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | N-[4-amino-5-cyano-6-(2-methoxyethoxy)-2-pyridinyl]-2-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11589125 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[4-amino-5-cyano-6-(2-methoxyethoxy)-2-pyridinyl]-2-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COCCOc1nc(NC(=O)Cc2cc(OC)ccc2OC)cc(N)c1C#N |
| InChI | InChI=1S/C19H22N4O5/c1-25-6-7-28-19-14(11-20)15(21)10-17(23-19)22-18(24)9-12-8-13(26-2)4-5-16(12)27-3/h4-5,8,10H,6-7,9H2,1-3H3,(H3,21,22,23,24) |
| InChIKey | GXSSKILQHZMJFZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|