C11H23NO2S2 — CID 115891428
N-(2,2-dimethyl-4-methylsulfonylbutyl)thiolan-3-amine (PubChem CID 115891428) has the molecular formula C11H23NO2S2 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-methylsulfonylbutyl)thiolan-3-amine.
| Compound Name | N-(2,2-dimethyl-4-methylsulfonylbutyl)thiolan-3-amine |
|---|---|
| PubChem CID | 115891428 |
| Molecular Formula | C11H23NO2S2 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(2,2-dimethyl-4-methylsulfonylbutyl)thiolan-3-amine |
| SMILES | CC(C)(CCS(C)(=O)=O)CNC1CCSC1 |
| InChI | InChI=1S/C11H23NO2S2/c1-11(2,5-7-16(3,13)14)9-12-10-4-6-15-8-10/h10,12H,4-9H2,1-3H3 |
| InChIKey | PNJOJXCZGZRFSB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |