C21H27NO4S — CID 11589190
methyl 2-[[(2Z,7Z)-cycloocta-2,7-dien-1-yl]-(4-methylphenyl)sulfonylamino]pent-4-enoate (PubChem CID 11589190) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is methyl 2-[[(2Z,7Z)-cycloocta-2,7-dien-1-yl]-(4-methylphenyl)sulfonylamino]pent-4-enoate.
| Compound Name | methyl 2-[[(2Z,7Z)-cycloocta-2,7-dien-1-yl]-(4-methylphenyl)sulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 11589190 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 2-[[(2Z,7Z)-cycloocta-2,7-dien-1-yl]-(4-methylphenyl)sulfonylamino]pent-4-enoate |
| SMILES | C=CCC(C(=O)OC)N(C1/C=C\CCC/C=C\1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-4-10-20(21(23)26-3)22(18-11-8-6-5-7-9-12-18)27(24,25)19-15-13-17(2)14-16-19/h4,8-9,11-16,18,20H,1,5-7,10H2,2-3H3/b11-8-,12-9- |
| InChIKey | QRJFHIDTOROHFY-QAHSQZNUSA-N |
| XLogP | 3.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|