C23H34O5 — CID 11589209
(1S,11S)-1-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one (PubChem CID 11589209) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (1S,11S)-1-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one.
| Compound Name | (1S,11S)-1-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one |
|---|---|
| PubChem CID | 11589209 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1S,11S)-1-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one |
| SMILES | COc1c2c(c(OC)c(C(C)C)c1OC)C(=O)C[C@H]1C(C)(C)CCC[C@]1(O)C2 |
| InChI | InChI=1S/C23H34O5/c1-13(2)17-20(27-6)18-14(19(26-5)21(17)28-7)12-23(25)10-8-9-22(3,4)16(23)11-15(18)24/h13,16,25H,8-12H2,1-7H3/t16-,23-/m0/s1 |
| InChIKey | WAOGUCABBIJGPT-HJPURHCSSA-N |
| XLogP | 4.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |