About [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol
[1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol (PubChem CID 115892905) has the molecular formula C17H24FNOS
and a molecular weight of 309.45 g/mol. Its IUPAC name is [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol |
| PubChem CID | 115892905 |
| Molecular Formula | C17H24FNOS |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol |
| SMILES | OCC1(CNC2CCSc3c(F)cccc32)CCCCC1 |
| InChI | InChI=1S/C17H24FNOS/c18-14-6-4-5-13-15(7-10-21-16(13)14)19-11-17(12-20)8-2-1-3-9-17/h4-6,15,19-20H,1-3,7-12H2 |
| InChIKey | LFPDEHFUJWQNCK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol?
The IUPAC name of [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol (CID 115892905) is [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol.
What is the SMILES notation for [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol?
The canonical SMILES for [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol is OCC1(CNC2CCSc3c(F)cccc32)CCCCC1.
What is the InChIKey of [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol?
The InChIKey is LFPDEHFUJWQNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24FNOS/c18-14-6-4-5-13-15(7-10-21-16(13)14)19-11-17(12-20)8-2-1-3-9-17/h4-6,15,19-20H,1-3,7-12H2.
What are the key properties of [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol?
[1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol has a molecular weight of 309.45 g/mol, XLogP of 3.89, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]cyclohexyl]methanol is sourced from PubChem (CID 115892905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).