C10H14F3NO — CID 115894673
4,4,4-trifluoro-N-[1-(furan-3-yl)ethyl]butan-2-amine (PubChem CID 115894673) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(furan-3-yl)ethyl]butan-2-amine.
| Compound Name | 4,4,4-trifluoro-N-[1-(furan-3-yl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 115894673 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(furan-3-yl)ethyl]butan-2-amine |
| SMILES | CC(CC(F)(F)F)NC(C)c1ccoc1 |
| InChI | InChI=1S/C10H14F3NO/c1-7(5-10(11,12)13)14-8(2)9-3-4-15-6-9/h3-4,6-8,14H,5H2,1-2H3 |
| InChIKey | XOHGYVQXEPTUML-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |