C12H19ClN2O — CID 115894976
3-[1-(2-chloro-4-pyridinyl)ethylamino]-2,2-dimethylpropan-1-ol (PubChem CID 115894976) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 3-[1-(2-chloro-4-pyridinyl)ethylamino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[1-(2-chloro-4-pyridinyl)ethylamino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115894976 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[1-(2-chloro-4-pyridinyl)ethylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(NCC(C)(C)CO)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O/c1-9(15-7-12(2,3)8-16)10-4-5-14-11(13)6-10/h4-6,9,15-16H,7-8H2,1-3H3 |
| InChIKey | MPXPMPHULPMPHA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|