C12H23N3O — CID 115895111
N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)oxan-3-amine (PubChem CID 115895111) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)oxan-3-amine.
| Compound Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)oxan-3-amine |
|---|---|
| PubChem CID | 115895111 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)oxan-3-amine |
| SMILES | C1COCC(NCC2CN3CCN2CC3)C1 |
| InChI | InChI=1S/C12H23N3O/c1-2-11(10-16-7-1)13-8-12-9-14-3-5-15(12)6-4-14/h11-13H,1-10H2 |
| InChIKey | KHYKFUVLCMRMBF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |