About 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol
2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol (PubChem CID 115895190) has the molecular formula C10H20F3NO
and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol |
| PubChem CID | 115895190 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol |
| SMILES | CCC(C)(CO)CNC(C)CC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO/c1-4-9(3,7-15)6-14-8(2)5-10(11,12)13/h8,14-15H,4-7H2,1-3H3 |
| InChIKey | BQUWTKMGHYBNDW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol?
The IUPAC name of 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol (CID 115895190) is 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol.
What is the SMILES notation for 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol?
The canonical SMILES for 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol is CCC(C)(CO)CNC(C)CC(F)(F)F.
What is the InChIKey of 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol?
The InChIKey is BQUWTKMGHYBNDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO/c1-4-9(3,7-15)6-14-8(2)5-10(11,12)13/h8,14-15H,4-7H2,1-3H3.
What are the key properties of 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol?
2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol has a molecular weight of 227.27 g/mol, XLogP of 2.33, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(4,4,4-trifluorobutan-2-ylamino)methyl]butan-1-ol is sourced from PubChem (CID 115895190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).