About N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine
N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine (PubChem CID 115895344) has the molecular formula C12H20F3N
and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine.
Molecular Properties
| Compound Name | N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine |
| PubChem CID | 115895344 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(CC(F)(F)F)NCC1(C2CC2)CCC1 |
| InChI | InChI=1S/C12H20F3N/c1-9(7-12(13,14)15)16-8-11(5-2-6-11)10-3-4-10/h9-10,16H,2-8H2,1H3 |
| InChIKey | JCGSKQZCKSFMGL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine?
The IUPAC name of N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine (CID 115895344) is N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine.
What is the SMILES notation for N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine?
The canonical SMILES for N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine is CC(CC(F)(F)F)NCC1(C2CC2)CCC1.
What is the InChIKey of N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine?
The InChIKey is JCGSKQZCKSFMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N/c1-9(7-12(13,14)15)16-8-11(5-2-6-11)10-3-4-10/h9-10,16H,2-8H2,1H3.
What are the key properties of N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine?
N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine has a molecular weight of 235.29 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-cyclopropylcyclobutyl)methyl]-4,4,4-trifluorobutan-2-amine is sourced from PubChem (CID 115895344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).