C13H19NO2 — CID 115896021
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(furan-2-yl)ethanamine (PubChem CID 115896021) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(furan-2-yl)ethanamine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 115896021 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(furan-2-yl)ethanamine |
| SMILES | CC(NCCC1=CCOCC1)c1ccco1 |
| InChI | InChI=1S/C13H19NO2/c1-11(13-3-2-8-16-13)14-7-4-12-5-9-15-10-6-12/h2-3,5,8,11,14H,4,6-7,9-10H2,1H3 |
| InChIKey | HPQLGJYDKVTVLQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|