About N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine (PubChem CID 115896034) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine |
| PubChem CID | 115896034 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine |
| SMILES | CCC1CCCC1NCCC1=CCOCC1 |
| InChI | InChI=1S/C14H25NO/c1-2-13-4-3-5-14(13)15-9-6-12-7-10-16-11-8-12/h7,13-15H,2-6,8-11H2,1H3 |
| InChIKey | UYAKXXOKRLHDSD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine?
The IUPAC name of N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine (CID 115896034) is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine.
What is the SMILES notation for N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine?
The canonical SMILES for N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine is CCC1CCCC1NCCC1=CCOCC1.
What is the InChIKey of N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine?
The InChIKey is UYAKXXOKRLHDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-2-13-4-3-5-14(13)15-9-6-12-7-10-16-11-8-12/h7,13-15H,2-6,8-11H2,1H3.
What are the key properties of N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine?
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine has a molecular weight of 223.36 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-ethylcyclopentan-1-amine is sourced from PubChem (CID 115896034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).