C9H10Cl2N2O — CID 115897478
4,5-dichloro-2-(2-methylidenebutyl)pyridazin-3-one (PubChem CID 115897478) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is 4,5-dichloro-2-(2-methylidenebutyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(2-methylidenebutyl)pyridazin-3-one |
|---|---|
| PubChem CID | 115897478 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 4,5-dichloro-2-(2-methylidenebutyl)pyridazin-3-one |
| SMILES | C=C(CC)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H10Cl2N2O/c1-3-6(2)5-13-9(14)8(11)7(10)4-12-13/h4H,2-3,5H2,1H3 |
| InChIKey | CXTQRGQJQQMWJO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|