C12H17N3O2S2 — CID 115897757
6-cyano-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 115897757) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 6-cyano-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115897757 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 6-cyano-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C12H17N3O2S2/c1-4-11(9-18-3)15(2)19(16,17)12-6-5-10(7-13)14-8-12/h5-6,8,11H,4,9H2,1-3H3 |
| InChIKey | PBWKPUXKYKGUPY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |