C12H14N4O3 — CID 1158978
4,6-dimethoxy-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 1158978) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1158978 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4,6-dimethoxy-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Nc2nc(OC)nc(OC)n2)cc1 |
| InChI | InChI=1S/C12H14N4O3/c1-17-9-6-4-8(5-7-9)13-10-14-11(18-2)16-12(15-10)19-3/h4-7H,1-3H3,(H,13,14,15,16) |
| InChIKey | BVGMVTOIICGAHT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |