About [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate
[(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate (PubChem CID 11589787) has the molecular formula C21H19FO6S
and a molecular weight of 418.44 g/mol. Its IUPAC name is [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate |
| PubChem CID | 11589787 |
| Molecular Formula | C21H19FO6S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@@]1(COC(=O)c2ccccc2)SC[C@@H](F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19FO6S/c1-14(23)28-21(13-26-19(24)15-8-4-2-5-9-15)18(17(22)12-29-21)27-20(25)16-10-6-3-7-11-16/h2-11,17-18H,12-13H2,1H3/t17-,18+,21+/m1/s1 |
| InChIKey | VLIGPJYUNHTUTF-LQWHRVPQSA-N |
| XLogP | 3.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate?
The IUPAC name of [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate (CID 11589787) is [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate.
What is the SMILES notation for [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate?
The canonical SMILES for [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate is CC(=O)O[C@@]1(COC(=O)c2ccccc2)SC[C@@H](F)[C@@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate?
The InChIKey is VLIGPJYUNHTUTF-LQWHRVPQSA-N. The full InChI is InChI=1S/C21H19FO6S/c1-14(23)28-21(13-26-19(24)15-8-4-2-5-9-15)18(17(22)12-29-21)27-20(25)16-10-6-3-7-11-16/h2-11,17-18H,12-13H2,1H3/t17-,18+,21+/m1/s1.
What are the key properties of [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate?
[(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate has a molecular weight of 418.44 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S,4S)-2-acetyloxy-3-benzoyloxy-4-fluorothiolan-2-yl]methyl benzoate is sourced from PubChem (CID 11589787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).