C25H27FN4O — CID 11589793
17-[3-[(4-fluorophenyl)methylamino]propyl]-14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11,14-pentaen-16-one (PubChem CID 11589793) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is 17-[3-[(4-fluorophenyl)methylamino]propyl]-14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11,14-pentaen-16-one.
| Compound Name | 17-[3-[(4-fluorophenyl)methylamino]propyl]-14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11,14-pentaen-16-one |
|---|---|
| PubChem CID | 11589793 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 17-[3-[(4-fluorophenyl)methylamino]propyl]-14-methyl-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,8,11,14-pentaen-16-one |
| SMILES | Cc1[nH]nc2c1c(=O)n(CCCNCc1ccc(F)cc1)c1cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C25H27FN4O/c1-16-23-24(29-28-16)21-13-18-5-2-3-6-19(18)14-22(21)30(25(23)31)12-4-11-27-15-17-7-9-20(26)10-8-17/h7-10,13-14,27H,2-6,11-12,15H2,1H3,(H,28,29) |
| InChIKey | CUMCEGVDNTVYTB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|