C23H25N5OS — CID 11589820
13-methyl-11-phenyl-4-piperazin-1-yl-6-propan-2-yloxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11589820) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is 13-methyl-11-phenyl-4-piperazin-1-yl-6-propan-2-yloxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 13-methyl-11-phenyl-4-piperazin-1-yl-6-propan-2-yloxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11589820 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 13-methyl-11-phenyl-4-piperazin-1-yl-6-propan-2-yloxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1cc(-c2ccccc2)nc2sc3c(OC(C)C)nc(N4CCNCC4)nc3c12 |
| InChI | InChI=1S/C23H25N5OS/c1-14(2)29-21-20-19(26-23(27-21)28-11-9-24-10-12-28)18-15(3)13-17(25-22(18)30-20)16-7-5-4-6-8-16/h4-8,13-14,24H,9-12H2,1-3H3 |
| InChIKey | AFPDPQGAJINDMF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |