C14H20N4O3 — CID 115898285
N-(2-methoxyethyl)-2-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]acetamide (PubChem CID 115898285) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 115898285 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[1-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]acetamide |
| SMILES | COCCNC(=O)CNC(C)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H20N4O3/c1-9(16-8-13(19)15-5-6-21-2)10-3-4-11-12(7-10)18-14(20)17-11/h3-4,7,9,16H,5-6,8H2,1-2H3,(H,15,19)(H2,17,18,20) |
| InChIKey | PWRBFDRLNVQXNL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|