C17H11BrF2N4O2 — CID 11589845
N-[5-(5-bromo-2-methoxy-3-pyridinyl)pyrazin-2-yl]-2,6-difluorobenzamide (PubChem CID 11589845) has the molecular formula C17H11BrF2N4O2 and a molecular weight of 421.20 g/mol. Its IUPAC name is N-[5-(5-bromo-2-methoxy-3-pyridinyl)pyrazin-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(5-bromo-2-methoxy-3-pyridinyl)pyrazin-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 11589845 |
| Molecular Formula | C17H11BrF2N4O2 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | N-[5-(5-bromo-2-methoxy-3-pyridinyl)pyrazin-2-yl]-2,6-difluorobenzamide |
| SMILES | COc1ncc(Br)cc1-c1cnc(NC(=O)c2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C17H11BrF2N4O2/c1-26-17-10(5-9(18)6-23-17)13-7-22-14(8-21-13)24-16(25)15-11(19)3-2-4-12(15)20/h2-8H,1H3,(H,22,24,25) |
| InChIKey | RUGQZWUSCYZRJA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |