C18H19ClN4O4S — CID 11589890
10-chloro-N-(diaminomethylidene)-8-(dimethylamino)-1-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11589890) has the molecular formula C18H19ClN4O4S and a molecular weight of 422.89 g/mol. Its IUPAC name is 10-chloro-N-(diaminomethylidene)-8-(dimethylamino)-1-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | 10-chloro-N-(diaminomethylidene)-8-(dimethylamino)-1-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11589890 |
| Molecular Formula | C18H19ClN4O4S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 10-chloro-N-(diaminomethylidene)-8-(dimethylamino)-1-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N=C(N)N)cc2c1Oc1c(Cl)cc(N(C)C)cc1CS2(=O)=O |
| InChI | InChI=1S/C18H19ClN4O4S/c1-9-4-10(17(24)22-18(20)21)6-14-15(9)27-16-11(8-28(14,25)26)5-12(23(2)3)7-13(16)19/h4-7H,8H2,1-3H3,(H4,20,21,22,24) |
| InChIKey | CIXPYAJJRPRMFM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|