C26H37NO2Si — CID 11589908
tert-butyl N-benzyl-N-[(3S)-2-[dimethyl(phenyl)silyl]-4-methylpent-1-en-3-yl]carbamate (PubChem CID 11589908) has the molecular formula C26H37NO2Si and a molecular weight of 423.67 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(3S)-2-[dimethyl(phenyl)silyl]-4-methylpent-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(3S)-2-[dimethyl(phenyl)silyl]-4-methylpent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 11589908 |
| Molecular Formula | C26H37NO2Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | tert-butyl N-benzyl-N-[(3S)-2-[dimethyl(phenyl)silyl]-4-methylpent-1-en-3-yl]carbamate |
| SMILES | C=C([C@H](C(C)C)N(Cc1ccccc1)C(=O)OC(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H37NO2Si/c1-20(2)24(21(3)30(7,8)23-17-13-10-14-18-23)27(25(28)29-26(4,5)6)19-22-15-11-9-12-16-22/h9-18,20,24H,3,19H2,1-2,4-8H3/t24-/m0/s1 |
| InChIKey | QACDABAEQLRHQJ-DEOSSOPVSA-N |
| XLogP | 6.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|