C12H11BrF6N2O3 — CID 11589930
2-bromo-N-[6-methyl-2,4-bis(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide (PubChem CID 11589930) has the molecular formula C12H11BrF6N2O3 and a molecular weight of 425.12 g/mol. Its IUPAC name is 2-bromo-N-[6-methyl-2,4-bis(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide.
| Compound Name | 2-bromo-N-[6-methyl-2,4-bis(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 11589930 |
| Molecular Formula | C12H11BrF6N2O3 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | 2-bromo-N-[6-methyl-2,4-bis(2,2,2-trifluoroethoxy)-3-pyridinyl]acetamide |
| SMILES | Cc1cc(OCC(F)(F)F)c(NC(=O)CBr)c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H11BrF6N2O3/c1-6-2-7(23-4-11(14,15)16)9(21-8(22)3-13)10(20-6)24-5-12(17,18)19/h2H,3-5H2,1H3,(H,21,22) |
| InChIKey | GYNJGZPJGHVNSB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|