C11H15N3S — CID 115899405
2-(1-methylsulfanylbutan-2-ylamino)pyridine-3-carbonitrile (PubChem CID 115899405) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-(1-methylsulfanylbutan-2-ylamino)pyridine-3-carbonitrile.
| Compound Name | 2-(1-methylsulfanylbutan-2-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 115899405 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-(1-methylsulfanylbutan-2-ylamino)pyridine-3-carbonitrile |
| SMILES | CCC(CSC)Nc1ncccc1C#N |
| InChI | InChI=1S/C11H15N3S/c1-3-10(8-15-2)14-11-9(7-12)5-4-6-13-11/h4-6,10H,3,8H2,1-2H3,(H,13,14) |
| InChIKey | IUKUVPZQZANSMD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |