About 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol
4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol (PubChem CID 115899447) has the molecular formula C10H18F3NO3
and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol |
| PubChem CID | 115899447 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol |
| SMILES | CN(CC(O)C(F)(F)F)CC1(O)CCOCC1 |
| InChI | InChI=1S/C10H18F3NO3/c1-14(6-8(15)10(11,12)13)7-9(16)2-4-17-5-3-9/h8,15-16H,2-7H2,1H3 |
| InChIKey | SKFQMFPXDPXZKT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
The IUPAC name of 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol (CID 115899447) is 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol is CN(CC(O)C(F)(F)F)CC1(O)CCOCC1.
What is the InChIKey of 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
The InChIKey is SKFQMFPXDPXZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO3/c1-14(6-8(15)10(11,12)13)7-9(16)2-4-17-5-3-9/h8,15-16H,2-7H2,1H3.
What are the key properties of 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol?
4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol has a molecular weight of 257.25 g/mol, XLogP of 0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxan-4-ol is sourced from PubChem (CID 115899447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).