C26H34O5 — CID 11589968
ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]acetate (PubChem CID 11589968) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]acetate.
| Compound Name | ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]acetate |
|---|---|
| PubChem CID | 11589968 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | ethyl 2-[3-[1-(4-cyclohexylphenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecan-9-ylidene]acetate |
| SMILES | C=C(c1ccc(C2CCCCC2)cc1)C1COC2(CCC(=CC(=O)OCC)CC2)OO1 |
| InChI | InChI=1S/C26H34O5/c1-3-28-25(27)17-20-13-15-26(16-14-20)29-18-24(30-31-26)19(2)21-9-11-23(12-10-21)22-7-5-4-6-8-22/h9-12,17,22,24H,2-8,13-16,18H2,1H3/b20-17- |
| InChIKey | XDVIKPLRIOQVGC-JZJYNLBNSA-N |
| XLogP | 5.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|