About 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol
3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 115900814) has the molecular formula C8H16F3NO3S
and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 115900814 |
| Molecular Formula | C8H16F3NO3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCS(=O)(=O)CC(C)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO3S/c1-3-16(14,15)5-6(2)12-4-7(13)8(9,10)11/h6-7,12-13H,3-5H2,1-2H3 |
| InChIKey | FKQQKQNUFJSTEF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol (CID 115900814) is 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol is CCS(=O)(=O)CC(C)NCC(O)C(F)(F)F.
What is the InChIKey of 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol?
The InChIKey is FKQQKQNUFJSTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO3S/c1-3-16(14,15)5-6(2)12-4-7(13)8(9,10)11/h6-7,12-13H,3-5H2,1-2H3.
What are the key properties of 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol?
3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol has a molecular weight of 263.28 g/mol, XLogP of 0.32, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethylsulfonylpropan-2-ylamino)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 115900814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).