C11H25NO2S — CID 115901103
N-(1-ethylsulfonylpropan-2-yl)-2,3-dimethylbutan-1-amine (PubChem CID 115901103) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is N-(1-ethylsulfonylpropan-2-yl)-2,3-dimethylbutan-1-amine.
| Compound Name | N-(1-ethylsulfonylpropan-2-yl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 115901103 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(1-ethylsulfonylpropan-2-yl)-2,3-dimethylbutan-1-amine |
| SMILES | CCS(=O)(=O)CC(C)NCC(C)C(C)C |
| InChI | InChI=1S/C11H25NO2S/c1-6-15(13,14)8-11(5)12-7-10(4)9(2)3/h9-12H,6-8H2,1-5H3 |
| InChIKey | VHFDSILLGLNSQE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |