C13H15N3O3S2 — CID 115902196
N-(2-hydroxyethyl)-N-(2-methoxyethyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 115902196) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(2-methoxyethyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 115902196 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(2-methoxyethyl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | COCCN(CCO)C(=O)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-19-6-3-15(2-5-17)12(18)10-8-9-11(21-10)14-13-16(9)4-7-20-13/h4,7-8,17H,2-3,5-6H2,1H3 |
| InChIKey | ZVTUJFHFXJYAGN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |