C18H29NOS — CID 115903696
N-[cyclohexyl(phenyl)methyl]-3-methylsulfinylbutan-1-amine (PubChem CID 115903696) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-3-methylsulfinylbutan-1-amine.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-3-methylsulfinylbutan-1-amine |
|---|---|
| PubChem CID | 115903696 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-3-methylsulfinylbutan-1-amine |
| SMILES | CC(CCNC(c1ccccc1)C1CCCCC1)S(C)=O |
| InChI | InChI=1S/C18H29NOS/c1-15(21(2)20)13-14-19-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3,5-6,9-10,15,17-19H,4,7-8,11-14H2,1-2H3 |
| InChIKey | DUSWUKYGIPKHNU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |