C24H32N2O4S — CID 11590382
4-[3-[[4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 11590382) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-[3-[[4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[3-[[4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 11590382 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 4-[3-[[4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | COc1ccc(C2CN(C)Cc3cc(OCCCN4CCS(=O)(=O)CC4)ccc32)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-25-17-20-16-22(30-13-3-10-26-11-14-31(27,28)15-12-26)8-9-23(20)24(18-25)19-4-6-21(29-2)7-5-19/h4-9,16,24H,3,10-15,17-18H2,1-2H3 |
| InChIKey | JXLGDCHDFPYUFA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|