About 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea
1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea (PubChem CID 115904156) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea |
| PubChem CID | 115904156 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea |
| SMILES | CN(C)CCCN(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H21N3O/c1-10(2)7-6-8-12(5)9(13)11(3)4/h6-8H2,1-5H3 |
| InChIKey | HAROAGPYGIYIPT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea?
The IUPAC name of 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea (CID 115904156) is 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea is CN(C)CCCN(C)C(=O)N(C)C.
What is the InChIKey of 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea?
The InChIKey is HAROAGPYGIYIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-10(2)7-6-8-12(5)9(13)11(3)4/h6-8H2,1-5H3.
What are the key properties of 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea?
1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea has a molecular weight of 187.29 g/mol, XLogP of 0.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(dimethylamino)propyl]-1,3,3-trimethylurea is sourced from PubChem (CID 115904156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).