C19H22N6O3S2 — CID 11590419
N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-yl)sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 11590419) has the molecular formula C19H22N6O3S2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-yl)sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-yl)sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 11590419 |
| Molecular Formula | C19H22N6O3S2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-yl)sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | CC1=C(C)C2c3nnc(SCC(=O)NNC(=O)c4ccco4)n3C(C(C)C)=NC2S1 |
| InChI | InChI=1S/C19H22N6O3S2/c1-9(2)15-20-18-14(10(3)11(4)30-18)16-22-24-19(25(15)16)29-8-13(26)21-23-17(27)12-6-5-7-28-12/h5-7,9,14,18H,8H2,1-4H3,(H,21,26)(H,23,27) |
| InChIKey | FJRUPNFCPAGCGE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|