About 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one
3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one (PubChem CID 11590436) has the molecular formula C23H19F2N7O
and a molecular weight of 447.45 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
| PubChem CID | 11590436 |
| Molecular Formula | C23H19F2N7O |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
| SMILES | CCC(Nc1ncnc2nc[nH]c12)c1nc2cccc(C)c2c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H19F2N7O/c1-3-16(30-21-19-20(27-10-26-19)28-11-29-21)22-31-17-6-4-5-12(2)18(17)23(33)32(22)15-8-13(24)7-14(25)9-15/h4-11,16H,3H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | WSFYPJICJPIWOT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one?
The IUPAC name of 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one (CID 11590436) is 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one.
What is the SMILES notation for 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one?
The canonical SMILES for 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one is CCC(Nc1ncnc2nc[nH]c12)c1nc2cccc(C)c2c(=O)n1-c1cc(F)cc(F)c1.
What is the InChIKey of 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one?
The InChIKey is WSFYPJICJPIWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F2N7O/c1-3-16(30-21-19-20(27-10-26-19)28-11-29-21)22-31-17-6-4-5-12(2)18(17)23(33)32(22)15-8-13(24)7-14(25)9-15/h4-11,16H,3H2,1-2H3,(H2,26,27,28,29,30).
What are the key properties of 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one?
3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one has a molecular weight of 447.45 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-5-methyl-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one is sourced from PubChem (CID 11590436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).