C22H14F3N5O3 — CID 11590543
4-[10-methyl-5-oxo-7-[3-(trifluoromethyl)phenyl]-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]benzoic acid (PubChem CID 11590543) has the molecular formula C22H14F3N5O3 and a molecular weight of 453.38 g/mol. Its IUPAC name is 4-[10-methyl-5-oxo-7-[3-(trifluoromethyl)phenyl]-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]benzoic acid.
| Compound Name | 4-[10-methyl-5-oxo-7-[3-(trifluoromethyl)phenyl]-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]benzoic acid |
|---|---|
| PubChem CID | 11590543 |
| Molecular Formula | C22H14F3N5O3 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 4-[10-methyl-5-oxo-7-[3-(trifluoromethyl)phenyl]-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]benzoic acid |
| SMILES | Cn1ncc2c3[nH]n(-c4ccc(C(=O)O)cc4)c(=O)c3c(-c3cccc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C22H14F3N5O3/c1-29-19-15(10-26-29)18-16(17(27-19)12-3-2-4-13(9-12)22(23,24)25)20(31)30(28-18)14-7-5-11(6-8-14)21(32)33/h2-10,28H,1H3,(H,32,33) |
| InChIKey | HYWGLFWNLHFOSD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|