C15H29NOS — CID 115906102
N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]thian-3-amine (PubChem CID 115906102) has the molecular formula C15H29NOS and a molecular weight of 271.47 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]thian-3-amine.
| Compound Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]thian-3-amine |
|---|---|
| PubChem CID | 115906102 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]thian-3-amine |
| SMILES | CC(C)COC1CC(NC2CCCSC2)C1(C)C |
| InChI | InChI=1S/C15H29NOS/c1-11(2)9-17-14-8-13(15(14,3)4)16-12-6-5-7-18-10-12/h11-14,16H,5-10H2,1-4H3 |
| InChIKey | NOFVCQQZJGCVND-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |