About 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine
3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine (PubChem CID 115906505) has the molecular formula C13H26FNO
and a molecular weight of 231.35 g/mol. Its IUPAC name is 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine |
| PubChem CID | 115906505 |
| Molecular Formula | C13H26FNO |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine |
| SMILES | CCOC1CC(NCCCF)C1(CC)CC |
| InChI | InChI=1S/C13H26FNO/c1-4-13(5-2)11(15-9-7-8-14)10-12(13)16-6-3/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | PXXOTAHTAJXITO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine?
The IUPAC name of 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine (CID 115906505) is 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine.
What is the SMILES notation for 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine?
The canonical SMILES for 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine is CCOC1CC(NCCCF)C1(CC)CC.
What is the InChIKey of 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine?
The InChIKey is PXXOTAHTAJXITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26FNO/c1-4-13(5-2)11(15-9-7-8-14)10-12(13)16-6-3/h11-12,15H,4-10H2,1-3H3.
What are the key properties of 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine?
3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine has a molecular weight of 231.35 g/mol, XLogP of 2.92, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine is sourced from PubChem (CID 115906505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).