C13H26FNO — CID 115906505
3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine (PubChem CID 115906505) has the molecular formula C13H26FNO and a molecular weight of 231.35 g/mol. Its IUPAC name is 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine.
| Compound Name | 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 115906505 |
| Molecular Formula | C13H26FNO |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-ethoxy-2,2-diethyl-N-(3-fluoropropyl)cyclobutan-1-amine |
| SMILES | CCOC1CC(NCCCF)C1(CC)CC |
| InChI | InChI=1S/C13H26FNO/c1-4-13(5-2)11(15-9-7-8-14)10-12(13)16-6-3/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | PXXOTAHTAJXITO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|