C11H19N3O — CID 115908239
N-(2,6-dimethyloxan-4-yl)-2-methylpyrazol-3-amine (PubChem CID 115908239) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2,6-dimethyloxan-4-yl)-2-methylpyrazol-3-amine.
| Compound Name | N-(2,6-dimethyloxan-4-yl)-2-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 115908239 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-(2,6-dimethyloxan-4-yl)-2-methylpyrazol-3-amine |
| SMILES | CC1CC(Nc2ccnn2C)CC(C)O1 |
| InChI | InChI=1S/C11H19N3O/c1-8-6-10(7-9(2)15-8)13-11-4-5-12-14(11)3/h4-5,8-10,13H,6-7H2,1-3H3 |
| InChIKey | VMUNNHYXPYLKLQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |