About N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine
N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine (PubChem CID 115908321) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine |
| PubChem CID | 115908321 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine |
| SMILES | CC1CC(NC2CC=CC2)CC(C)O1 |
| InChI | InChI=1S/C12H21NO/c1-9-7-12(8-10(2)14-9)13-11-5-3-4-6-11/h3-4,9-13H,5-8H2,1-2H3 |
| InChIKey | CLHZEPXLPGOEKV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine?
The IUPAC name of N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine (CID 115908321) is N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine.
What is the SMILES notation for N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine?
The canonical SMILES for N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine is CC1CC(NC2CC=CC2)CC(C)O1.
What is the InChIKey of N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine?
The InChIKey is CLHZEPXLPGOEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-9-7-12(8-10(2)14-9)13-11-5-3-4-6-11/h3-4,9-13H,5-8H2,1-2H3.
What are the key properties of N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine?
N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine has a molecular weight of 195.31 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopent-3-en-1-yl-2,6-dimethyloxan-4-amine is sourced from PubChem (CID 115908321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).