C5H4F4N4S — CID 115908685
2-amino-6-(1,1,2,2-tetrafluoroethyl)-1H-1,3,5-triazine-4-thione (PubChem CID 115908685) has the molecular formula C5H4F4N4S and a molecular weight of 228.17 g/mol. Its IUPAC name is 2-amino-6-(1,1,2,2-tetrafluoroethyl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-(1,1,2,2-tetrafluoroethyl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 115908685 |
| Molecular Formula | C5H4F4N4S |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-amino-6-(1,1,2,2-tetrafluoroethyl)-1H-1,3,5-triazine-4-thione |
| SMILES | Nc1nc(=S)nc(C(F)(F)C(F)F)[nH]1 |
| InChI | InChI=1S/C5H4F4N4S/c6-1(7)5(8,9)2-11-3(10)13-4(14)12-2/h1H,(H3,10,11,12,13,14) |
| InChIKey | XWKZNDGMKMFVQP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|